HEXYL TIGLATE
Catalog No: FT-0627065
CAS No: 16930-96-4
- Chemical Name: HEXYL TIGLATE
- Molecular Formula: C11H20O2
- Molecular Weight: 184.27
- InChI Key: JTCIUOKKVACNCK-BJMVGYQFSA-N
- InChI: InChI=1S/C11H20O2/c1-4-6-7-8-9-13-11(12)10(3)5-2/h5H,4,6-9H2,1-3H3/b10-5+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 184.27500 |
| Density: | 0.894 g/mL at 25ºC(lit.) |
| CAS: | 16930-96-4 |
| Bolling_Point: | 234.8ºC at 760 mmHg |
| Product_Name: | hexyl tiglate |
| Melting_Point: | N/A |
| Flash_Point: | 98.3ºC |
| MF: | C11H20O2 |
| Density: | 0.894 g/mL at 25ºC(lit.) |
|---|---|
| LogP: | 3.07610 |
| Flash_Point: | 98.3ºC |
| Refractive_Index: | n20/D 1.446(lit.) |
| FW: | 184.27500 |
| PSA: | 26.30000 |
| MF: | C11H20O2 |
| Bolling_Point: | 234.8ºC at 760 mmHg |
| Vapor_Pressure: | 0.0519mmHg at 25°C |
| Exact_Mass: | 184.14600 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| RTECS: | GQ5780000 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2916190090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)